ChemNet > CAS > 175137-12-9 3-chloro-4-methylthiophene-2-carbohydrazide
175137-12-9 3-chloro-4-methylthiophene-2-carbohydrazide
termék neve |
3-chloro-4-methylthiophene-2-carbohydrazide |
MF |
C6H7ClN2OS |
Molekulatömeg |
190.6506 |
InChI |
InChI=1/C6H7ClN2OS/c1-3-2-11-5(4(3)7)6(10)9-8/h2H,8H2,1H3,(H,9,10) |
CAS-szám |
175137-12-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.415g/cm3 |
Olvadáspont |
130℃ |
Törésmutató |
1.613 |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|