ChemNet > CAS > 187657-92-7 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone
187657-92-7 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone
termék neve |
1-(1-benzofuran-3-yl)-2-bromo-1-ethanone |
Szinonimák |
[2,4-bis(methylsulfonyl)phenyl]hydrazine; 1-(1-benzofuran-3-yl)-2-bromoethanone |
MF |
C10H7BrO2 |
Molekulatömeg |
239.0654 |
InChI |
InChI=1/C10H7BrO2/c11-5-9(12)8-6-13-10-4-2-1-3-7(8)10/h1-4,6H,5H2 |
CAS-szám |
187657-92-7 |
EINECS |
260-718-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.582g/cm3 |
Olvadáspont |
136℃ |
Forráspont |
306.8°C at 760 mmHg |
Törésmutató |
1.636 |
Gyulladáspont |
139.3°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|