ChemNet > CAS > 18791-98-5 3-Bromothiophene-2-carbonitrile
18791-98-5 3-Bromothiophene-2-carbonitrile
termék neve |
3-Bromothiophene-2-carbonitrile |
Szinonimák |
3-Bromo-2-cyanothiophene |
MF |
C5H2BrNS |
Molekulatömeg |
188.0451 |
InChI |
InChI=1/C5H2BrNS/c6-4-1-2-8-5(4)3-7/h1-2H |
CAS-szám |
18791-98-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.82g/cm3 |
Forráspont |
286.8°C at 760 mmHg |
Törésmutató |
1.641 |
Gyulladáspont |
127.3°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|