ChemNet > CAS > 189807-20-3 2,3,6-trifluorobenzoyl chloride
189807-20-3 2,3,6-trifluorobenzoyl chloride
termék neve |
2,3,6-trifluorobenzoyl chloride |
Szinonimák |
Trifluorobenzoylchloride |
MF |
C7H2ClF3O |
Molekulatömeg |
194.5384 |
InChI |
InChI=1/C7H2ClF3O/c8-7(12)5-3(9)1-2-4(10)6(5)11/h1-2H |
CAS-szám |
189807-20-3 |
Molekuláris szerkezete |
|
Sűrűség |
1.514g/cm3 |
Forráspont |
180.1°C at 760 mmHg |
Törésmutató |
1.479 |
Gyulladáspont |
59°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|