ChemNet > CAS > 19013-10-6 Ethyl 4-hydroxy-3-nitrobenzoate
19013-10-6 Ethyl 4-hydroxy-3-nitrobenzoate
termék neve |
Ethyl 4-hydroxy-3-nitrobenzoate |
Szinonimák |
4-Hydroxy-3-nitrobenzoic acid ethyl ester |
MF |
C9H9NO5 |
Molekulatömeg |
211.1715 |
InChI |
InChI=1/C9H9NO5/c1-2-15-9(12)6-3-4-8(11)7(5-6)10(13)14/h3-5,11H,2H2,1H3 |
CAS-szám |
19013-10-6 |
EINECS |
242-751-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.37g/cm3 |
Forráspont |
323.5°C at 760 mmHg |
Törésmutató |
1.577 |
Gyulladáspont |
149.5°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|