ChemNet > CAS > 19462-98-7 5,6-Dichlorobenzimidazole-2-thiol
19462-98-7 5,6-Dichlorobenzimidazole-2-thiol
| termék neve |
5,6-Dichlorobenzimidazole-2-thiol |
| Szinonimák |
5,6-Dichloro-1H-benzo[d]imidazole-2-thiol; 5,6-dichloro-1,3-dihydro-2H-benzimidazole-2-thione |
| MF |
C7H4Cl2N2S |
| Molekulatömeg |
219.0911 |
| InChI |
InChI=1/C7H4Cl2N2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
| CAS-szám |
19462-98-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.68g/cm3 |
| Olvadáspont |
300℃ |
| Forráspont |
329.8°C at 760 mmHg |
| Törésmutató |
1.755 |
| Gyulladáspont |
153.3°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
