ChemNet > CAS > 20028-40-4 (1-Methyl-1H-benzimidazol-2-yl)methylamine
20028-40-4 (1-Methyl-1H-benzimidazol-2-yl)methylamine
termék neve |
(1-Methyl-1H-benzimidazol-2-yl)methylamine |
Szinonimák |
1-(1-methyl-1H-benzimidazol-2-yl)methanamine; (1-methyl-1H-benzimidazol-2-yl)methanaminium |
MF |
C9H12N3 |
Molekulatömeg |
162.2111 |
InChI |
InChI=1/C9H11N3/c1-12-8-5-3-2-4-7(8)11-9(12)6-10/h2-5H,6,10H2,1H3/p+1 |
CAS-szám |
20028-40-4 |
Molekuláris szerkezete |
|
Forráspont |
332.7°C at 760 mmHg |
Gyulladáspont |
155°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|