ChemNet > CAS > 20029-52-1 Cyclohexybenzoicacid
20029-52-1 Cyclohexybenzoicacid
termék neve |
Cyclohexybenzoicacid |
Szinonimák |
4-Cyclohexylbenzoic acid; 4-cyclohexylbenzoate |
MF |
C13H15O2 |
Molekulatömeg |
203.2575 |
InChI |
InChI=1/C13H16O2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10H,1-5H2,(H,14,15)/p-1 |
CAS-szám |
20029-52-1 |
EINECS |
243-472-5 |
Molekuláris szerkezete |
|
Forráspont |
351.1°C at 760 mmHg |
Gyulladáspont |
163.9°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|