ChemNet > CAS > 203436-48-0 4-(2-thienyl)benzylamine
203436-48-0 4-(2-thienyl)benzylamine
termék neve |
4-(2-thienyl)benzylamine |
Szinonimák |
1-(4-thiophen-2-ylphenyl)methanamine; 4-(1,3-oxazol-5-yl)benzoic acid |
MF |
C10H7NO3 |
Molekulatömeg |
189.1675 |
InChI |
InChI=1/C10H7NO3/c12-10(13)8-3-1-7(2-4-8)9-5-11-6-14-9/h1-6H,(H,12,13) |
CAS-szám |
203436-48-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.32g/cm3 |
Forráspont |
390.3°C at 760 mmHg |
Törésmutató |
1.587 |
Gyulladáspont |
189.8°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|