ChemNet > CAS > 20949-81-9 2-phenyl-1,3-thiazole-4-carbaldehyde
20949-81-9 2-phenyl-1,3-thiazole-4-carbaldehyde
termék neve |
2-phenyl-1,3-thiazole-4-carbaldehyde |
Szinonimák |
2-phenylthiazole-4-carbaldehyde |
MF |
C10H7NOS |
Molekulatömeg |
189.2337 |
InChI |
InChI=1/C10H7NOS/c12-6-9-7-13-10(11-9)8-4-2-1-3-5-8/h1-7H |
CAS-szám |
20949-81-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.269g/cm3 |
Olvadáspont |
45℃ |
Forráspont |
353°C at 760 mmHg |
Törésmutató |
1.645 |
Gyulladáspont |
167.3°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|