ChemNet > CAS > 2144-37-8 Methyl 5-(chloromethyl)-2-furoate
2144-37-8 Methyl 5-(chloromethyl)-2-furoate
| termék neve |
Methyl 5-(chloromethyl)-2-furoate |
| Szinonimák |
methyl 5-(chloromethyl)furan-2-carboxylate; 5-CHLOROMETHYL-FURAN-2-CARBOXYLIC ACID METHYL ESTER |
| MF |
C7H7ClO3 |
| Molekulatömeg |
174.5817 |
| InChI |
InChI=1/C7H7ClO3/c1-10-7(9)6-3-2-5(4-8)11-6/h2-3H,4H2,1H3 |
| CAS-szám |
2144-37-8 |
| EINECS |
218-405-8 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.266g/cm3 |
| Olvadáspont |
31℃ |
| Forráspont |
268.2°C at 760 mmHg |
| Törésmutató |
1.493 |
| Gyulladáspont |
116°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
