ChemNet > CAS > 21667-62-9 3-Chlorobenzoylacetonitrile,
21667-62-9 3-Chlorobenzoylacetonitrile,
| termék neve |
3-Chlorobenzoylacetonitrile, |
| Szinonimák |
3-Chlorobenzoylacetonitrile; 3-(3-Chlorophenyl)-3-oxopropanenitrile |
| MF |
C9H6ClNO |
| Molekulatömeg |
179.603 |
| InChI |
InChI=1/C9H6ClNO/c10-8-3-1-2-7(6-8)9(12)4-5-11/h1-3,6H,4H2 |
| CAS-szám |
21667-62-9 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.257g/cm3 |
| Olvadáspont |
78℃ |
| Forráspont |
347.1°C at 760 mmHg |
| Törésmutató |
1.553 |
| Gyulladáspont |
163.7°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
