ChemNet > CAS > 2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
termék neve |
4-Chloro-alpha-methylphenylacetonitrile |
Szinonimák |
2-(p-Chlorophenyl)propionitrile; 2-(4-chlorophenyl)propanenitrile |
MF |
C9H8ClN |
Molekulatömeg |
165.6195 |
InChI |
InChI=1/C9H8ClN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,1H3 |
CAS-szám |
2184-88-5 |
EINECS |
218-569-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.143g/cm3 |
Forráspont |
260.3°C at 760 mmHg |
Törésmutató |
1.537 |
Gyulladáspont |
104°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|