ChemNet > CAS > 220141-73-1 3,4,5-trifluoroacetophenone
220141-73-1 3,4,5-trifluoroacetophenone
termék neve |
3,4,5-trifluoroacetophenone |
Szinonimák |
3',4',5'-Trifluoroacetophenone; 1-(3,4,5-trifluorophenyl)ethanone |
MF |
C8H5F3O |
Molekulatömeg |
174.1199 |
InChI |
InChI=1/C8H5F3O/c1-4(12)5-2-6(9)8(11)7(10)3-5/h2-3H,1H3 |
CAS-szám |
220141-73-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.303g/cm3 |
Forráspont |
208.8°C at 760 mmHg |
Törésmutató |
1.455 |
Gyulladáspont |
72.5°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|