ChemNet > CAS > 22814-92-2 4-(4-Chlorophenyl)-thiosemicarbazide
22814-92-2 4-(4-Chlorophenyl)-thiosemicarbazide
termék neve |
4-(4-Chlorophenyl)-thiosemicarbazide |
Szinonimák |
4-(4-Chlorophenyl)-3-thiosemicarbazide; N-(4-chlorophenyl)hydrazinecarbothioamide |
MF |
C7H8ClN3S |
Molekulatömeg |
201.6765 |
InChI |
InChI=1/C7H8ClN3S/c8-5-1-3-6(4-2-5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
CAS-szám |
22814-92-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.458g/cm3 |
Forráspont |
318.3°C at 760 mmHg |
Törésmutató |
1.729 |
Gyulladáspont |
146.3°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R25:Toxic if swallowed.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|