ChemNet > CAS > 2305-26-2 Cyclohexenedicarboxylicacid
2305-26-2 Cyclohexenedicarboxylicacid
termék neve |
Cyclohexenedicarboxylicacid |
Szinonimák |
(1R,2S)-Cyclohex-4-ene-1,2-dicarboxylic acid; 4-cyclohexene-1,2-dicarboxylic acid, (1R,2S)-; 4-Cyclohexene-1,2-dicarboxylic acid, (1R,2S)-rel-; 4-Cyclohexene-1,2-dicarboxylic acid, cis-; Cis-4-cyclohexene-1,2-dicarboxylic acid |
MF |
C8H10O4 |
Molekulatömeg |
170.1626 |
InChI |
InChI=1/C8H10O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-2,5-6H,3-4H2,(H,9,10)(H,11,12)/t5-,6+ |
CAS-szám |
2305-26-2 |
EINECS |
218-974-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.369g/cm3 |
Forráspont |
395.4°C at 760 mmHg |
Törésmutató |
1.548 |
Gyulladáspont |
207.1°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|