ChemNet > CAS > 2315-86-8 3-Bromo-4-hydroxybenzonitrile
2315-86-8 3-Bromo-4-hydroxybenzonitrile
| termék neve |
3-Bromo-4-hydroxybenzonitrile |
| Szinonimák |
2-Bromo-4-cyanophenol |
| MF |
C7H4BrNO |
| Molekulatömeg |
198.0168 |
| InChI |
InChI=1/C7H4BrNO/c8-6-3-5(4-9)1-2-7(6)10/h1-3,10H |
| CAS-szám |
2315-86-8 |
| EINECS |
219-022-9 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.79g/cm3 |
| Olvadáspont |
155℃ |
| Forráspont |
271.1°C at 760 mmHg |
| Törésmutató |
1.656 |
| Gyulladáspont |
117.8°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|
