ChemNet > CAS > 23173-76-4 1-Benzyl-4-(ethoxycarbonylmethyl)piperazine
23173-76-4 1-Benzyl-4-(ethoxycarbonylmethyl)piperazine
termék neve |
1-Benzyl-4-(ethoxycarbonylmethyl)piperazine |
Szinonimák |
N-Benzyl-N-(carboethoxymethyl)piperazine; ethyl (4-benzylpiperazin-1-yl)acetate; ethyl 2-(4-benzylpiperazin-1-yl)acetate |
MF |
C15H22N2O2 |
Molekulatömeg |
262.3474 |
InChI |
InChI=1/C15H22N2O2/c1-2-19-15(18)13-17-10-8-16(9-11-17)12-14-6-4-3-5-7-14/h3-7H,2,8-13H2,1H3 |
CAS-szám |
23173-76-4 |
Molekuláris szerkezete |
|
Sűrűség |
1.088g/cm3 |
Forráspont |
360.7°C at 760 mmHg |
Törésmutató |
1.535 |
Gyulladáspont |
172°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|