ChemNet > CAS > 233585-04-1 2,6-dihydroxy-3-nitrobenzonitrile
233585-04-1 2,6-dihydroxy-3-nitrobenzonitrile
| termék neve |
2,6-dihydroxy-3-nitrobenzonitrile |
| MF |
C7H4N2O4 |
| Molekulatömeg |
180.1177 |
| InChI |
InChI=1/C7H4N2O4/c8-3-4-6(10)2-1-5(7(4)11)9(12)13/h1-2,10-11H |
| CAS-szám |
233585-04-1 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.69g/cm3 |
| Olvadáspont |
238℃ |
| Forráspont |
358.2°C at 760 mmHg |
| Törésmutató |
1.683 |
| Gyulladáspont |
170.5°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
