ChemNet > CAS > 2510-55-6 9-Cyanophenanthrene
2510-55-6 9-Cyanophenanthrene
termék neve |
9-Cyanophenanthrene |
Szinonimák |
Cyanophenanthrene; phenanthrene-9-carbonitrile |
MF |
C15H9N |
Molekulatömeg |
203.2387 |
InChI |
InChI=1/C15H9N/c16-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h1-9H |
CAS-szám |
2510-55-6 |
EINECS |
219-725-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.2g/cm3 |
Olvadáspont |
110-112℃ |
Forráspont |
413.8°C at 760 mmHg |
Törésmutató |
1.719 |
Gyulladáspont |
205.4°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21:Harmful by inhalation and in contact with skin.;
|
Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|