ChemNet > CAS > 2628-17-3 4-Vinylphenol
2628-17-3 4-Vinylphenol
termék neve |
4-Vinylphenol |
Szinonimák |
4-Hydroxystyrene; p-Vinylphenol; 4'-Hydroxystyrene |
MF |
C8H8O |
Molekulatömeg |
120.15 |
InChI |
InChI=1/C8H8O/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2 |
CAS-szám |
2628-17-3 |
EINECS |
220-103-6 |
Molekuláris szerkezete |
|
Olvadáspont |
73℃ |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|