ChemNet > CAS > 2700-22-3 Benzylidenemalononitrile
2700-22-3 Benzylidenemalononitrile
| termék neve |
Benzylidenemalononitrile |
| Szinonimák |
beta,beta-styrenedicarbonitrile; Benzalmalononitrile; 2-benzylidenemalononitrile; benzylidenepropanedinitrile |
| MF |
C10H6N2 |
| Molekulatömeg |
154.168 |
| InChI |
InChI=1/C10H6N2/c11-7-10(8-12)6-9-4-2-1-3-5-9/h1-6H |
| CAS-szám |
2700-22-3 |
| EINECS |
220-283-6 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.154g/cm3 |
| Olvadáspont |
82-86℃ |
| Forráspont |
294.8°C at 760 mmHg |
| Törésmutató |
1.612 |
| Gyulladáspont |
138°C |
| Veszély szimbólumok |
 T:Toxic;
|
| Kockázatot kódok |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
