ChemNet > CAS > 275-51-4 Azulene
275-51-4 Azulene
termék neve |
Azulene |
Szinonimák |
Bicyclo[5.3.0]decapentaene; Azunamic; Cyclopentacycloheptene; Bicyclo(5.3.0)-deca-2,4,6,8,10-pentaene; Bicyclo(5.3.0)-1,3,5,7,9-decapentaene; EINECS |
MF |
C10H8 |
Molekulatömeg |
128.1705 |
InChI |
InChI=1/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H |
CAS-szám |
275-51-4 |
EINECS |
205-993-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.037g/cm3 |
Olvadáspont |
99-101℃ |
Forráspont |
220.7°C at 760 mmHg |
Törésmutató |
1.632 |
Gyulladáspont |
76.7°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|