ChemNet > CAS > 31545-26-3 4-Chloro-3-nitrophenyl cyclopropyl ketone
31545-26-3 4-Chloro-3-nitrophenyl cyclopropyl ketone
termék neve |
4-Chloro-3-nitrophenyl cyclopropyl ketone |
Szinonimák |
(4-chloro-3-nitrophenyl)(cyclopropyl)methanone |
MF |
C10H8ClNO3 |
Molekulatömeg |
225.6284 |
InChI |
InChI=1/C10H8ClNO3/c11-8-4-3-7(5-9(8)12(14)15)10(13)6-1-2-6/h3-6H,1-2H2 |
CAS-szám |
31545-26-3 |
EINECS |
250-690-4 |
Molekuláris szerkezete |
|
Sűrűség |
1.464g/cm3 |
Olvadáspont |
78-80℃ |
Forráspont |
333.4°C at 760 mmHg |
Törésmutató |
1.631 |
Gyulladáspont |
155.4°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|