ChemNet > CAS > 32852-81-6 3-Phenoxyphenylacetic acid
32852-81-6 3-Phenoxyphenylacetic acid
| termék neve |
3-Phenoxyphenylacetic acid |
| Szinonimák |
3-Phenoxyphenylacetic |
| MF |
C14H12O3 |
| Molekulatömeg |
228.2433 |
| InChI |
InChI=1/C14H12O3/c15-14(16)10-11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-9H,10H2,(H,15,16) |
| CAS-szám |
32852-81-6 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.217g/cm3 |
| Forráspont |
385.4°C at 760 mmHg |
| Törésmutató |
1.596 |
| Gyulladáspont |
147.4°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
