ChemNet > CAS > 33143-29-2 2,2-dimethyl-2H-chromene-6-carbonitrile
33143-29-2 2,2-dimethyl-2H-chromene-6-carbonitrile
| termék neve |
2,2-dimethyl-2H-chromene-6-carbonitrile |
| Szinonimák |
2,2-Dimethyl-2H-chromeme-6-carbonitrile |
| MF |
C12H11NO |
| Molekulatömeg |
185.2218 |
| InChI |
InChI=1/C12H11NO/c1-12(2)6-5-10-7-9(8-13)3-4-11(10)14-12/h3-7H,1-2H3 |
| CAS-szám |
33143-29-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.13g/cm3 |
| Olvadáspont |
48℃ |
| Forráspont |
301°C at 760 mmHg |
| Törésmutató |
1.578 |
| Gyulladáspont |
126.8°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|
