ChemNet > CAS > 3319-01-5 1-Cyclohexylpiperidine
3319-01-5 1-Cyclohexylpiperidine
termék neve |
1-Cyclohexylpiperidine |
Szinonimák |
1-Piperidinocyclohexane; N-cyclohexylpiperidine |
MF |
C11H21N |
Molekulatömeg |
167.2911 |
InChI |
InChI=1/C11H21N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h11H,1-10H2 |
CAS-szám |
3319-01-5 |
EINECS |
222-016-9 |
Molekuláris szerkezete |
|
Sűrűség |
0.941g/cm3 |
Forráspont |
234.3°C at 760 mmHg |
Törésmutató |
1.501 |
Gyulladáspont |
101.4°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|