ChemNet > CAS > 33898-90-7 2-Thenoylacetonitrile
33898-90-7 2-Thenoylacetonitrile
termék neve |
2-Thenoylacetonitrile |
Szinonimák |
3-Oxo-3-(2-thienyl)propionitrile; 3-Oxo-3-(2-thienyl)propanenitrile; 3-oxo-3-(thiophen-2-yl)propanenitrile |
MF |
C7H5NOS |
Molekulatömeg |
151.1857 |
InChI |
InChI=1/C7H5NOS/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
CAS-szám |
33898-90-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.256g/cm3 |
Olvadáspont |
128-134℃ |
Forráspont |
338.3°C at 760 mmHg |
Törésmutató |
1.565 |
Gyulladáspont |
158.4°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|