ChemNet > CAS > 33901-44-9 4-Methylphenoxyacetonitrile
33901-44-9 4-Methylphenoxyacetonitrile
termék neve |
4-Methylphenoxyacetonitrile |
MF |
C9H9NO |
Molekulatömeg |
147.1739 |
InChI |
InChI=1/C9H9NO/c1-8-2-4-9(5-3-8)11-7-6-10/h2-5H,7H2,1H3 |
CAS-szám |
33901-44-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.054g/cm3 |
Forráspont |
262.5°C at 760 mmHg |
Törésmutató |
1.517 |
Gyulladáspont |
109.8°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|