ChemNet > CAS > 342411-14-7 2,1,3-benzothiadiazol-4-yl isocyanate
342411-14-7 2,1,3-benzothiadiazol-4-yl isocyanate
| termék neve |
2,1,3-benzothiadiazol-4-yl isocyanate |
| Szinonimák |
4-isocyanato-2,1,3-benzothiadiazole |
| MF |
C7H3N3OS |
| Molekulatömeg |
177.1832 |
| InChI |
InChI=1/C7H3N3OS/c11-4-8-5-2-1-3-6-7(5)10-12-9-6/h1-3H |
| CAS-szám |
342411-14-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.55g/cm3 |
| Olvadáspont |
77℃ |
| Forráspont |
268.1°C at 760 mmHg |
| Törésmutató |
1.772 |
| Gyulladáspont |
115.9°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
