ChemNet > CAS > 35354-37-1 1-Bromo-5-methylhexane
35354-37-1 1-Bromo-5-methylhexane
termék neve |
1-Bromo-5-methylhexane |
MF |
C7H15Br |
Molekulatömeg |
179.098 |
InChI |
InChI=1/C7H15Br/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3 |
CAS-szám |
35354-37-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.136g/cm3 |
Forráspont |
168°C at 760 mmHg |
Törésmutató |
1.447 |
Gyulladáspont |
48.4°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|