ChemNet > CAS > 3612-16-6 1-Ethyl-3-methyl-4-piperidone
3612-16-6 1-Ethyl-3-methyl-4-piperidone
termék neve |
1-Ethyl-3-methyl-4-piperidone |
Szinonimák |
1-ethyl-3-methylpiperidin-4-one |
MF |
C8H15NO |
Molekulatömeg |
141.2108 |
InChI |
InChI=1/C8H15NO/c1-3-9-5-4-8(10)7(2)6-9/h7H,3-6H2,1-2H3 |
CAS-szám |
3612-16-6 |
Molekuláris szerkezete |
|
Sűrűség |
0.931g/cm3 |
Forráspont |
212.3°C at 760 mmHg |
Törésmutató |
1.45 |
Gyulladáspont |
76.2°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|