ChemNet > CAS > 38291-82-6 Valeric acid hydrazide
38291-82-6 Valeric acid hydrazide
termék neve |
Valeric acid hydrazide |
Szinonimák |
Pentanoic acid hydrazide; pentanehydrazide |
MF |
C5H12N2O |
Molekulatömeg |
116.1616 |
InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
CAS-szám |
38291-82-6 |
EINECS |
253-864-8 |
Molekuláris szerkezete |
|
Sűrűség |
0.962g/cm3 |
Forráspont |
260.6°C at 760 mmHg |
Törésmutató |
1.449 |
Gyulladáspont |
111.4°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|