ChemNet > CAS > 39943-56-1 3,5-Dichlorophenylhydrazine
39943-56-1 3,5-Dichlorophenylhydrazine
termék neve |
3,5-Dichlorophenylhydrazine |
MF |
C6H6Cl2N2 |
Molekulatömeg |
177.0312 |
InChI |
InChI=1/C6H6Cl2N2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,10H,9H2 |
CAS-szám |
39943-56-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.475g/cm3 |
Forráspont |
286.1°C at 760 mmHg |
Törésmutató |
1.665 |
Gyulladáspont |
126.8°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|