ChemNet > CAS > 42048-11-3 2-Chloro-6-iodotoluene
42048-11-3 2-Chloro-6-iodotoluene
termék neve |
2-Chloro-6-iodotoluene |
Szinonimák |
1-Chloro-3-iodo-2-methylbenzene; 2-Iodo-6-chlorotoluene |
MF |
C7H6ClI |
Molekulatömeg |
252.48 |
InChI |
InChI=1/C7H6ClI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
CAS-szám |
42048-11-3 |
Molekuláris szerkezete |
|
Sűrűség |
1.806g/cm3 |
Forráspont |
243°C at 760 mmHg |
Törésmutató |
1.616 |
Gyulladáspont |
100.8°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|