ChemNet > CAS > 42087-80-9 Methyl 4-Chloro-2-Nitrobenzoate
42087-80-9 Methyl 4-Chloro-2-Nitrobenzoate
termék neve |
Methyl 4-Chloro-2-Nitrobenzoate |
Szinonimák |
4-Chloro-2-nitrobenzoic acid methyl ester |
MF |
C8H6ClNO4 |
Molekulatömeg |
215.5905 |
InChI |
InChI=1/C8H6ClNO4/c1-14-8(11)6-3-2-5(9)4-7(6)10(12)13/h2-4H,1H3 |
CAS-szám |
42087-80-9 |
EINECS |
255-654-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.426g/cm3 |
Olvadáspont |
43-45℃ |
Forráspont |
285.6°C at 760 mmHg |
Törésmutató |
1.568 |
Gyulladáspont |
126.5°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|