ChemNet > CAS > 43111-32-6 3-Chlorophenoxyacetonitrile
43111-32-6 3-Chlorophenoxyacetonitrile
| termék neve |
3-Chlorophenoxyacetonitrile |
| MF |
C8H6ClNO |
| Molekulatömeg |
167.5923 |
| InChI |
InChI=1/C8H6ClNO/c9-7-2-1-3-8(6-7)11-5-4-10/h1-3,6H,5H2 |
| CAS-szám |
43111-32-6 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.238g/cm3 |
| Olvadáspont |
30℃ |
| Forráspont |
279.8°C at 760 mmHg |
| Törésmutató |
1.538 |
| Gyulladáspont |
123°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|
