ChemNet > CAS > 452-68-6 2-Fluoro-5-Iodotoluene
452-68-6 2-Fluoro-5-Iodotoluene
termék neve |
2-Fluoro-5-Iodotoluene |
MF |
C7H6FI |
Molekulatömeg |
236.02 |
InChI |
InChI=1/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
CAS-szám |
452-68-6 |
EINECS |
207-206-1 |
Molekuláris szerkezete |
|
Veszély szimbólumok |
|
Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|