ChemNet > CAS > 486-84-0 Harmane
486-84-0 Harmane
| termék neve |
Harmane |
| Szinonimák |
1-Methyl-9H-pyrido[3,4-b]indole; Aribine~1-Methyl-9H-pyrido[3,4-b]indole; harman; 1-methyl-9H-beta-carboline
; 2-Methyl-?carboline; Aribine; 1-methyl-9H-beta-carboline |
| MF |
C12H10N2 |
| Molekulatömeg |
182.2212 |
| InChI |
InChI=1/C12H10N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-7,14H,1H3 |
| CAS-szám |
486-84-0 |
| EINECS |
207-642-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.252g/cm3 |
| Olvadáspont |
235-239℃ |
| Forráspont |
386.9°C at 760 mmHg |
| Törésmutató |
1.75 |
| Gyulladáspont |
176.2°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Biztonsági Leírás |
S22:Do not inhale dust.;
|
|
