ChemNet > CAS > 496-76-4 2,4,5-Trihydroxypyrimidine
496-76-4 2,4,5-Trihydroxypyrimidine
termék neve |
2,4,5-Trihydroxypyrimidine |
Szinonimák |
Isobarbituric acid; 5-hydroxypyrimidine-2,4(1H,3H)-dione; dihydropyrimidine-2,4,5(3H)-trione |
MF |
C4H4N2O3 |
Molekulatömeg |
128.0862 |
InChI |
InChI=1/C4H4N2O3/c7-2-1-5-4(9)6-3(2)8/h1H2,(H2,5,6,8,9) |
CAS-szám |
496-76-4 |
EINECS |
207-829-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.455g/cm3 |
Olvadáspont |
300℃ |
Törésmutató |
1.492 |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|