ChemNet > CAS > 51628-12-7 4-Iodophenylacetonitrile
51628-12-7 4-Iodophenylacetonitrile
termék neve |
4-Iodophenylacetonitrile |
Szinonimák |
4-Iodobenzyl cyanide |
MF |
C8H6IN |
Molekulatömeg |
243.0444 |
InChI |
InChI=1/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
CAS-szám |
51628-12-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.764g/cm3 |
Forráspont |
285.8°C at 760 mmHg |
Törésmutató |
1.624 |
Gyulladáspont |
126.6°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|