ChemNet > CAS > 10079-53-5;5344-78-5 4-bromo-3-nitroanisole
10079-53-5;5344-78-5 4-bromo-3-nitroanisole
termék neve |
4-bromo-3-nitroanisole |
Szinonimák |
4-BROMO-3-NITROTHIOANISOLE; TIMTEC-BB SBB009974; 1-bromo-4-methoxy-2-nitrobenzene |
MF |
C7H6BrNO3 |
Molekulatömeg |
232.0314 |
InChI |
InChI=1/C7H6BrNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
CAS-szám |
10079-53-5;5344-78-5 |
EINECS |
226-290-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.64g/cm3 |
Olvadáspont |
32-34℃ |
Forráspont |
291°C at 760 mmHg |
Törésmutató |
1.581 |
Gyulladáspont |
123°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|