ChemNet > CAS > 5351-91-7 2-(2-thienylmethylidene)hydrazine-1-carbothioamide
5351-91-7 2-(2-thienylmethylidene)hydrazine-1-carbothioamide
| termék neve |
2-(2-thienylmethylidene)hydrazine-1-carbothioamide |
| Szinonimák |
Hydrazinecarbothioamide, 2-(2-thienylmethylene)- (9CI); 2-Formylthiophene thiosemicarbazone; 2-Thiophenealdehyde thiosemicarbazone; 2-Thiophenecarbaldehyde thiosemicarbazone; AI3-52012; Semicarbazide, 4-(thenylidene)-2-thio-; 2-Thiophenecarboxaldehyde, thiosemicarbazone; 2-(thiophen-2-ylmethylidene)hydrazinecarbothioamide; thiophene-2-carbaldehyde thiosemicarbazone |
| MF |
C6H7N3S2 |
| Molekulatömeg |
185.2699 |
| InChI |
InChI=1/C6H7N3S2/c7-6(10)9-8-4-5-2-1-3-11-5/h1-4H,(H3,7,9,10)/b8-4+ |
| CAS-szám |
5351-91-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.42g/cm3 |
| Olvadáspont |
187℃ |
| Forráspont |
329.5°C at 760 mmHg |
| Törésmutató |
1.71 |
| Gyulladáspont |
153.1°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
