ChemNet > CAS > 5422-88-8 Cyclopentyl phenyl ketone
5422-88-8 Cyclopentyl phenyl ketone
termék neve |
Cyclopentyl phenyl ketone |
Szinonimák |
Benzoylcyclopentane; cyclopentyl(phenyl)methanone |
MF |
C12H14O |
Molekulatömeg |
174.239 |
InChI |
InChI=1/C12H14O/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2 |
CAS-szám |
5422-88-8 |
EINECS |
226-548-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.051g/cm3 |
Forráspont |
273.9°C at 760 mmHg |
Törésmutató |
1.548 |
Gyulladáspont |
112.4°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|