CAS No: 5600-19-1, Chemical Name: 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1)
the physical and chemical property of 5600-19-1, 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1) is provided by ChemNet.com
ChemNet > CAS > 5600-19-1 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1)
5600-19-1 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1)
| termék neve |
3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1) |
| Szinonimák |
Theophylline isopropanolamine; 3,7-Dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1); 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione; 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 1-aminopropan-2-ol (1:1) |
| MF |
C10H17N5O3 |
| Molekulatömeg |
255.2737 |
| InChI |
InChI=1/C7H8N4O2.C3H9NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-3(5)2-4/h3H,1-2H3,(H,8,9);3,5H,2,4H2,1H3 |
| CAS-szám |
5600-19-1 |
| EINECS |
227-017-8 |
| Molekuláris szerkezete |
|
| Forráspont |
454.1°C at 760 mmHg |
| Gyulladáspont |
228.4°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
|
|
