ChemNet > CAS > 56341-36-7 1,5-Dimethyl-2-pyrrolecarbonitrile
56341-36-7 1,5-Dimethyl-2-pyrrolecarbonitrile
| termék neve |
1,5-Dimethyl-2-pyrrolecarbonitrile |
| Szinonimák |
1,5-Dimethylpyrrole-2-carbonitrile; 1,5-dimethyl-1H-pyrrole-2-carbonitrile; 1,2-Dimethyl-5-cyanopyrrole |
| MF |
C7H8N2 |
| Molekulatömeg |
120.1518 |
| InChI |
InChI=1/C7H8N2/c1-6-3-4-7(5-8)9(6)2/h3-4H,1-2H3 |
| CAS-szám |
56341-36-7 |
| EINECS |
260-120-6 |
| Molekuláris szerkezete |
|
| Sűrűség |
0.98g/cm3 |
| Olvadáspont |
53-56℃ |
| Forráspont |
238.9°C at 760 mmHg |
| Törésmutató |
1.529 |
| Gyulladáspont |
104.4°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
