ChemNet > CAS > 5751-82-6 Ethyl 5-chlorothiophene-2-carboxylate
5751-82-6 Ethyl 5-chlorothiophene-2-carboxylate
| termék neve |
Ethyl 5-chlorothiophene-2-carboxylate |
| Szinonimák |
5-Chlorothiophene-2-carboxylic acid ethyl ester; Ethyl 5-chlorothiophene-2-carboxlate;
|
| MF |
C7H7ClO2S |
| Molekulatömeg |
190.6473 |
| InChI |
InChI=1/C7H7ClO2S/c1-2-10-7(9)5-3-4-6(8)11-5/h3-4H,2H2,1H3 |
| CAS-szám |
5751-82-6 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.312g/cm3 |
| Forráspont |
253.7°C at 760 mmHg |
| Törésmutató |
1.545 |
| Gyulladáspont |
107.3°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
