ChemNet > CAS > 578-46-1 5-Methyl-2-nitroaniline
578-46-1 5-Methyl-2-nitroaniline
| termék neve |
5-Methyl-2-nitroaniline |
| Szinonimák |
3-Amino-4-nitrotoluene; 6-Nitro-m-toluidine; 5-Methyl-2-nitrophenylamine; 5-Methyl-2-nitro phenylamine |
| MF |
C7H8N2O2 |
| Molekulatömeg |
152.1506 |
| InChI |
InChI=1/C7H8N2O2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,8H2,1H3 |
| CAS-szám |
578-46-1 |
| EINECS |
209-423-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.269g/cm3 |
| Forráspont |
312.4°C at 760 mmHg |
| Törésmutató |
1.615 |
| Gyulladáspont |
142.8°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Biztonsági Leírás |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
