ChemNet > CAS > 583-03-9 Fenipentol
583-03-9 Fenipentol
termék neve |
Fenipentol |
Szinonimák |
.alpha.-Butylbenzenemethanol; .alpha.-Butylbenzyl alcohol; 1-Phenylpentan-1-ol; 583-03-9; a-Butylbenzyl Alcohol; Benzenemethanol, .alpha.-butyl-; benzenemethanol, alpha-butyl-; Benzyl alcohol, .alpha.-butyl-; Butyl hydroxy toluene |
MF |
C11H16O |
Molekulatömeg |
164.2441 |
InChI |
InChI=1/C11H16O/c1-2-3-9-11(12)10-7-5-4-6-8-10/h4-8,11-12H,2-3,9H2,1H3 |
CAS-szám |
583-03-9 |
EINECS |
209-493-9 |
Molekuláris szerkezete |
|
Sűrűség |
0.965g/cm3 |
Forráspont |
245.2°C at 760 mmHg |
Törésmutató |
1.514 |
Gyulladáspont |
110.7°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|