ChemNet > CAS > 589-91-3 4-Methylcyclohexanol, mixture of cis and trans
589-91-3 4-Methylcyclohexanol, mixture of cis and trans
termék neve |
4-Methylcyclohexanol, mixture of cis and trans |
Szinonimák |
4-Methylcyclohexanol (cis+trans); 4-Methylcyclohexanol; trans-4-methylcyclohexanol; Methyl cyclohexanol |
MF |
C7H14O |
Molekulatömeg |
114.1855 |
InChI |
InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
CAS-szám |
589-91-3 |
EINECS |
209-664-8 |
Molekuláris szerkezete |
|
Sűrűség |
0.925g/cm3 |
Olvadáspont |
-41℃ |
Forráspont |
170.322°C at 760 mmHg |
Törésmutató |
1.463 |
Gyulladáspont |
70°C |
Vízben való oldhatóság |
slightly soluble |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:;
|
|